
Product highlights
* Multilingual operation
* Automatic built in test and self diagnosis
* Secure access Key
* Uninterruptable power supply (UPS)
* Threat alert and material classification
* Auto archiving
* Network-Ready
* Energy saving design
* One key turn off
* Drugs and explosives inspection
* Indication of the date and time
* baggage counter


Security x-ray scanner equipment to detect explosive, weapons
Model: AT-5030A ------ scan hold, parcel baggages
------------------------------------
X-ray scanner equipment general specification:
* Tunnel Size: 500(W)*300(H)mm
* Conveyor Speed: 0.22m/s
* Conveyor Max Load: 150kg
* Resolution< 0.101mm Copper Wire
* Penetration: 10mm Steel
* Film Safety: Guarantee ISO1600 Film
* X-ray Leakage <0.1 μ Gy/h (at a distance of 5cm From external housing)
______________________________________________________________
X-ray scanner equipment generator:
* Generate direct: upward
* Generate anger: 80 degree
* Anode Voltage: 80Kv
* Anode power: 0.6mA
* Cooling /Â Duty Cycle: Oil Cooling /100%
________________________________________________________________
Security x-ray scanners Image System:
* X-ray Sensor: L-Shaped Photodiode Array (multi-energetic), 12bit Deep
* Monitor: High Resolution Color, LCD Accord, 17 inch
* Image Processing: Edge enhancement, image strengthening, image lightening, , reducing darkening, image returning, image retrieval.
* Image Grey Level: 4096
* Image Max Resolution: 1024 *Â 1280 pixel
* Image Processing: 24bit for processing real time
* Image storage: Storage 60000 pictures in real time
* Zoom: 32 Times Enlarge, Whole screen continuous observation
* Multi-energetic distinguish objects: Organic objects in orange, inorganic objects in blue, mixture in green
* Assist to detect drug and explosive powder
____________________________________________________________________
Security x-ray equipment Installation Data:
* Operation temperature/Humidity: 0º C-45º C/20%-95%(non-condensing)
* Storage Temperature/Humidity: -20º C-60º C/20%-95%(non-condensing)
* Operation Power: 187~240VAC(± 10%)50± 3Hz
* Power Consumption: 0.5 KWÂ
* Noise: <58dB
>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>
Safeway Inspection System Limited.Â
Address: Room 308, EÂ Building, QiFeng Digital Park, BaiNiKeng, PingHu Street,
                LongGang District, Shenzhen, China, 518108
Tel: 0755-89342235Â Â /Â Â Fax: 0755-89342650
Mobile: +Â 86- 136 7021 3490
Â
Website: www.cargovehicleinspection.comÂ
To be the best manufacturer of cargo and vehicle inspection system

Product highlights
* Multilingual operation
* Automatic built in test and self diagnosis
* Secure access Key
* Uninterruptable power supply (UPS)
* Threat alert and material classification
* Auto archiving
* Network-Ready
* Energy saving design
* One key turn off
* Drugs and explosives inspection
* Indication of the date and time
* baggage counter


Security x-ray scanner equipment to detect explosive, weapons
Model: AT-5030A ------ scan hold, parcel baggages
------------------------------------
X-ray scanner equipment general specification:
* Tunnel Size: 500(W)*300(H)mm
* Conveyor Speed: 0.22m/s
* Conveyor Max Load: 150kg
* Resolution< 0.101mm Copper Wire
* Penetration: 10mm Steel
* Film Safety: Guarantee ISO1600 Film
* X-ray Leakage <0.1 μ Gy/h (at a distance of 5cm From external housing)
______________________________________________________________
X-ray scanner equipment generator:
* Generate direct: upward
* Generate anger: 80 degree
* Anode Voltage: 80Kv
* Anode power: 0.6mA
* Cooling /Â Duty Cycle: Oil Cooling /100%
________________________________________________________________
Security x-ray scanners Image System:
* X-ray Sensor: L-Shaped Photodiode Array (multi-energetic), 12bit Deep
* Monitor: High Resolution Color, LCD Accord, 17 inch
* Image Processing: Edge enhancement, image strengthening, image lightening, , reducing darkening, image returning, image retrieval.
* Image Grey Level: 4096
* Image Max Resolution: 1024 *Â 1280 pixel
* Image Processing: 24bit for processing real time
* Image storage: Storage 60000 pictures in real time
* Zoom: 32 Times Enlarge, Whole screen continuous observation
* Multi-energetic distinguish objects: Organic objects in orange, inorganic objects in blue, mixture in green
* Assist to detect drug and explosive powder
____________________________________________________________________
Security x-ray equipment Installation Data:
* Operation temperature/Humidity: 0º C-45º C/20%-95%(non-condensing)
* Storage Temperature/Humidity: -20º C-60º C/20%-95%(non-condensing)
* Operation Power: 187~240VAC(± 10%)50± 3Hz
* Power Consumption: 0.5 KWÂ
* Noise: <58dB
>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>>
Safeway Inspection System Limited.Â
Address: Room 308, EÂ Building, QiFeng Digital Park, BaiNiKeng, PingHu Street,
                LongGang District, Shenzhen, China, 518108
Tel: 0755-89342235Â Â /Â Â Fax: 0755-89342650
Mobile: +Â 86- 136 7021 3490
Â
Website: www.cargovehicleinspection.comÂ
To be the best manufacturer of cargo and vehicle inspection system
Temperature Inductance Resistor is produced by nickel foil, and is mainly used for temperature measuring and Load Cell temperature compensation.
The temperature inductange resistor produced by our company has the advantages of long liability and good uniformity, the functions of creep and temperature self compensation, suitable for batch production of alloy steel, aluminum ally and stainless steel load cells with high accuracy, and for producing other load cells and force and strain measuring elements.
Temperature Inductance Resistor
Precision Resistor,Temperature Measuring Resistor,Nickel Foil Temperature Inductance Resistor,Temperature Inductance Resistor
SHANDONG JINZHONG SCIENCE & TECHNOLOGY GROUP COMPANY LIMITED , https://www.chinagoldbell.com